Products 1590209-76-9
CAS 1590209-76-9 is the registry number for 5-Bromo-N-(piperidin-3-ylmethyl)picolinamide hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-(piperidin-3-ylmethyl)pyridine-2-carboxamide;hydrochloride (CAS 1590209-76-9) is a chemical compound with the molecular formula C12H17BrClN3O and a molecular weight of 334.64 g/mol. IUPAC name: 5-bromo-N-(piperidin-3-ylmethyl)pyridine-2-carboxamide;hydrochloride. InChIKey: MWRLYEXAWLMGAU-UHFFFAOYSA-N.
| Molecular formula | C12H17BrClN3O |
|---|---|
| Molecular weight | 334.64 g/mol |
| IUPAC name | 5-bromo-N-(piperidin-3-ylmethyl)pyridine-2-carboxamide;hydrochloride |
| InChIKey | MWRLYEXAWLMGAU-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)CNC(=O)C2=NC=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)