Products 15903-94-3
CAS 15903-94-3 appears in our catalog under these names: 6-Benzyloxyindole, 6–Benzyloxyindole, 6-Benzyloxyindole, 97% , 6-Benzyloxyindole, >98.0%(GC), 6-Benzyloxyindole 96%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 250mg, 50mg, 10g, 5g, 1g, 25g, 50g, 100g.
6-phenylmethoxy-1H-indole (CAS 15903-94-3) is a chemical compound with the molecular formula C15H13NO and a molecular weight of 223.27 g/mol. IUPAC name: 6-phenylmethoxy-1H-indole. InChIKey: FPMICYBCFBLGOZ-UHFFFAOYSA-N.
| Molecular formula | C15H13NO |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 6-phenylmethoxy-1H-indole |
| InChIKey | FPMICYBCFBLGOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)C=CN3 |
Computed by PubChem (NCBI)