Products 15904-54-8

CAS 15904-54-8 is the registry number for 2-(Diethylamino)ethanesulfonic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

2-(diethylamino)ethanesulfonic acid (CAS 15904-54-8) is a chemical compound with the molecular formula C6H15NO3S and a molecular weight of 181.26 g/mol. IUPAC name: 2-(diethylamino)ethanesulfonic acid. InChIKey: OIXSOQOJISAETD-UHFFFAOYSA-N.

Identity
Molecular formulaC6H15NO3S
Molecular weight181.26 g/mol
IUPAC name2-(diethylamino)ethanesulfonic acid
InChIKeyOIXSOQOJISAETD-UHFFFAOYSA-N
SMILESCCN(CC)CCS(=O)(=O)O

Computed by PubChem (NCBI)