Products 1590403-33-0
CAS 1590403-33-0 appears in our catalog under these names: AK3287, GDC-3280, 98.82%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 10mM/1mL, 100 mg, 50 mg, 5 mg.
1-methyl-7-(1-methylpyrazol-4-yl)-5-[4-(trifluoromethoxy)phenyl]imidazo[4,5-c]pyridin-4-one (CAS 1590403-33-0) is a chemical compound with the molecular formula C18H14F3N5O2 and a molecular weight of 389.3 g/mol. IUPAC name: 1-methyl-7-(1-methylpyrazol-4-yl)-5-[4-(trifluoromethoxy)phenyl]imidazo[4,5-c]pyridin-4-one. InChIKey: ZJBCIWSBSPECFD-UHFFFAOYSA-N.
| Molecular formula | C18H14F3N5O2 |
|---|---|
| Molecular weight | 389.3 g/mol |
| IUPAC name | 1-methyl-7-(1-methylpyrazol-4-yl)-5-[4-(trifluoromethoxy)phenyl]imidazo[4,5-c]pyridin-4-one |
| InChIKey | ZJBCIWSBSPECFD-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=CN(C(=O)C3=C2N(C=N3)C)C4=CC=C(C=C4)OC(F)(F)F |
Computed by PubChem (NCBI)