CAS 1310347-50-2 appears in our catalog under these names: BACE1-IN-1, 98%, BACE1–IN–1, BACE1-IN-1, BACE1-IN-1, 99.02%, 99.02%, BACE1-IN-1, 98.72%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 50mg, 25mg, 100 mg, 10mM/1mL.
N-[3-[(4R)-2-amino-5,5-difluoro-4-methyl-6H-1,3-oxazin-4-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide (CAS 1310347-50-2) is a chemical compound with the molecular formula C18H14F3N5O2 and a molecular weight of 389.3 g/mol. IUPAC name: N-[3-[(4R)-2-amino-5,5-difluoro-4-methyl-6H-1,3-oxazin-4-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide. InChIKey: DVMUZHLUMHPCGZ-QGZVFWFLSA-N.
| Molecular formula | C18H14F3N5O2 |
|---|---|
| Molecular weight | 389.3 g/mol |
| IUPAC name | N-[3-[(4R)-2-amino-5,5-difluoro-4-methyl-6H-1,3-oxazin-4-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide |
| InChIKey | DVMUZHLUMHPCGZ-QGZVFWFLSA-N |
| SMILES | C[C@]1(C(COC(=N1)N)(F)F)C2=C(C=CC(=C2)NC(=O)C3=NC=C(C=C3)C#N)F |
Computed by PubChem (NCBI)