CAS 1590417-52-9 is the registry number for 4-Bis(4-Chlorophenyl)methyl-1,3-dimethoxybenzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
1-[bis(4-chlorophenyl)methyl]-2,4-dimethoxybenzene (CAS 1590417-52-9) is a chemical compound with the molecular formula C21H18Cl2O2 and a molecular weight of 373.3 g/mol. IUPAC name: 1-[bis(4-chlorophenyl)methyl]-2,4-dimethoxybenzene. InChIKey: CEJDJXWRGZCLEU-UHFFFAOYSA-N.
| Molecular formula | C21H18Cl2O2 |
|---|---|
| Molecular weight | 373.3 g/mol |
| IUPAC name | 1-[bis(4-chlorophenyl)methyl]-2,4-dimethoxybenzene |
| InChIKey | CEJDJXWRGZCLEU-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(C2=CC=C(C=C2)Cl)C3=CC=C(C=C3)Cl)OC |
Computed by PubChem (NCBI)