CAS 159054-14-5 appears in our catalog under these names: 3–(4,6–Dichloro–2–(ethoxycarbonyl)–1H–indol–3–yl)acrylic acid, 3-(4,6-Dichloro-2-(ethoxycarbonyl)-1H-indol-3-yl)acrylic acid 95%, 2-Ethyl 3-[(1E)-2-carboxyethenyl]-4,6-dichloro-1H-indole-2-carboxylate, 95%, 95%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(E)-3-(4,6-dichloro-2-ethoxycarbonyl-1H-indol-3-yl)prop-2-enoic acid (CAS 159054-14-5) is a chemical compound with the molecular formula C14H11Cl2NO4 and a molecular weight of 328.1 g/mol. IUPAC name: (E)-3-(4,6-dichloro-2-ethoxycarbonyl-1H-indol-3-yl)prop-2-enoic acid. InChIKey: LKKCOOJMPHIVOU-ONEGZZNKSA-N.
| Molecular formula | C14H11Cl2NO4 |
|---|---|
| Molecular weight | 328.1 g/mol |
| IUPAC name | (E)-3-(4,6-dichloro-2-ethoxycarbonyl-1H-indol-3-yl)prop-2-enoic acid |
| InChIKey | LKKCOOJMPHIVOU-ONEGZZNKSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(N1)C=C(C=C2Cl)Cl)/C=C/C(=O)O |
Computed by PubChem (NCBI)