CAS 1591-95-3 appears in our catalog under these names: Pentafluorophenyl isocyanate, 95%, Pentafluorophenyl isocyanate, PENTAFLUOROPHENYL ISOCYANATE, 97%, Pentafluorophenyl isocyanate, 96%. Offered by: Combi-blocks, Biosynth, Sigma-Aldrich, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 0,5g, 2g, 10g, 5ML.
1,2,3,4,5-pentafluoro-6-isocyanatobenzene (CAS 1591-95-3) is a chemical compound with the molecular formula C7F5NO and a molecular weight of 209.07 g/mol. IUPAC name: 1,2,3,4,5-pentafluoro-6-isocyanatobenzene. InChIKey: QXLDBWRLZDBVGF-UHFFFAOYSA-N.
| Molecular formula | C7F5NO |
|---|---|
| Molecular weight | 209.07 g/mol |
| IUPAC name | 1,2,3,4,5-pentafluoro-6-isocyanatobenzene |
| InChIKey | QXLDBWRLZDBVGF-UHFFFAOYSA-N |
| SMILES | C(=NC1=C(C(=C(C(=C1F)F)F)F)F)=O |
Computed by PubChem (NCBI)