Products 159138-81-5
CAS 159138-81-5 is the registry number for Cariporide (mesilate). Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(diaminomethylidene)-3-methylsulfonyl-4-propan-2-ylbenzamide;methanesulfonic acid (CAS 159138-81-5) is a chemical compound with the molecular formula C13H21N3O6S2 and a molecular weight of 379.5 g/mol. IUPAC name: N-(diaminomethylidene)-3-methylsulfonyl-4-propan-2-ylbenzamide;methanesulfonic acid. InChIKey: FNDLQABGYJQJPH-UHFFFAOYSA-N.
| Molecular formula | C13H21N3O6S2 |
|---|---|
| Molecular weight | 379.5 g/mol |
| IUPAC name | N-(diaminomethylidene)-3-methylsulfonyl-4-propan-2-ylbenzamide;methanesulfonic acid |
| InChIKey | FNDLQABGYJQJPH-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=C(C=C1)C(=O)N=C(N)N)S(=O)(=O)C.CS(=O)(=O)O |
Computed by PubChem (NCBI)