CAS 159141-33-0 appears in our catalog under these names: Alanyl Glutamine Impurity 21, N-[(2R)-2-Cl-Propanoyl]-Gln-OH 97%, (S)-5-Amino-2-((R)-2-chloropropanamido)-5-oxopentanoic acid, 97%, 97%, L-Glutamine, N2-[(2R)-2-chloro-1-oxopropyl]-, 97%. Offered by: Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 100g, 25g, 5g.
(2S)-5-amino-2-[[(2R)-2-chloropropanoyl]amino]-5-oxopentanoic acid (CAS 159141-33-0) is a chemical compound with the molecular formula C8H13ClN2O4 and a molecular weight of 236.65 g/mol. IUPAC name: (2S)-5-amino-2-[[(2R)-2-chloropropanoyl]amino]-5-oxopentanoic acid. InChIKey: JAKFXLPGGKWCLJ-UHNVWZDZSA-N.
| Molecular formula | C8H13ClN2O4 |
|---|---|
| Molecular weight | 236.65 g/mol |
| IUPAC name | (2S)-5-amino-2-[[(2R)-2-chloropropanoyl]amino]-5-oxopentanoic acid |
| InChIKey | JAKFXLPGGKWCLJ-UHNVWZDZSA-N |
| SMILES | C[C@H](C(=O)N[C@@H](CCC(=O)N)C(=O)O)Cl |
Computed by PubChem (NCBI)