CAS 159155-05-2 appears in our catalog under these names: (S)–3–hydroxy–2–(2,4,6–triisopropylphenylsulfonamido)propanoic acid, (S)-3-Hydroxy-2-(2,4,6-triisopropylphenylsulfonamido)propanoic acid, 95%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
(2S)-3-hydroxy-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]propanoic acid (CAS 159155-05-2) is a chemical compound with the molecular formula C18H29NO5S and a molecular weight of 371.5 g/mol. IUPAC name: (2S)-3-hydroxy-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]propanoic acid. InChIKey: ONSICJUKYJYQGH-INIZCTEOSA-N.
| Molecular formula | C18H29NO5S |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | (2S)-3-hydroxy-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]propanoic acid |
| InChIKey | ONSICJUKYJYQGH-INIZCTEOSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)S(=O)(=O)N[C@@H](CO)C(=O)O)C(C)C |
Computed by PubChem (NCBI)