CAS 15917-65-4 appears in our catalog under these names: Tamoxifen EP Impurity F HCl, N-Desmethyl Tamoxifen Hydrochloride, >95% (HPLC), 2-(4-((Z)-1,2-Diphenylbut-1-enyl)phenoxy)-N-methylethanamine Hydrochloride, Tamoxifen Citrate EP Impurity F (as Hydrochloride), N-Desmethyltamoxifen hydrochloride/ 99.34% (existing batch purity). Offered by: Chemat Brand, TRC, Mikromol, TargetMol, GLPBio. Available pack sizes: on request, 10mg, 25mg, 5mg, 4x25mg, 100mg, 1mg, 50mg.
2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N-methylethanamine;hydrochloride (CAS 15917-65-4) is a chemical compound with the molecular formula C25H28ClNO and a molecular weight of 393.9 g/mol. IUPAC name: 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N-methylethanamine;hydrochloride. InChIKey: GMLHJWZEYLTNJW-BJFQDICYSA-N.
| Molecular formula | C25H28ClNO |
|---|---|
| Molecular weight | 393.9 g/mol |
| IUPAC name | 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N-methylethanamine;hydrochloride |
| InChIKey | GMLHJWZEYLTNJW-BJFQDICYSA-N |
| SMILES | CC/C(=C(\C1=CC=CC=C1)/C2=CC=C(C=C2)OCCNC)/C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)