Products 159191-44-3

CAS 159191-44-3 appears in our catalog under these names: 4-(Dibenzylamino)phenylboronic acid, 95%, (4-(Dibenzylamino)phenyl)boronic acid 95%, (4-(Dibenzylamino)phenyl)boronic acid, 95%, 95%, (4-(Dibenzylamino)phenyl)boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

[4-(dibenzylamino)phenyl]boronic acid (CAS 159191-44-3) is a chemical compound with the molecular formula C20H20BNO2 and a molecular weight of 317.2 g/mol. IUPAC name: [4-(dibenzylamino)phenyl]boronic acid. InChIKey: KLGQJKOCSXZOBV-UHFFFAOYSA-N.

Identity
Molecular formulaC20H20BNO2
Molecular weight317.2 g/mol
IUPAC name[4-(dibenzylamino)phenyl]boronic acid
InChIKeyKLGQJKOCSXZOBV-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)N(CC2=CC=CC=C2)CC3=CC=CC=C3)(O)O

Computed by PubChem (NCBI)