CAS 15920-89-5 is the registry number for N-Carbamoyl-L-Arginine. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(carbamoylamino)-5-(diaminomethylideneamino)pentanoic acid (CAS 15920-89-5) is a chemical compound with the molecular formula C7H15N5O3 and a molecular weight of 217.23 g/mol. IUPAC name: (2S)-2-(carbamoylamino)-5-(diaminomethylideneamino)pentanoic acid. InChIKey: GNRVMKVZOPHHAO-BYPYZUCNSA-N.
| Molecular formula | C7H15N5O3 |
|---|---|
| Molecular weight | 217.23 g/mol |
| IUPAC name | (2S)-2-(carbamoylamino)-5-(diaminomethylideneamino)pentanoic acid |
| InChIKey | GNRVMKVZOPHHAO-BYPYZUCNSA-N |
| SMILES | C(C[C@@H](C(=O)O)NC(=O)N)CN=C(N)N |
Computed by PubChem (NCBI)