CAS 1592097-56-7 is the registry number for 5-Bromo-2-chloro-nicotinic acid hydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-bromo-2-chloropyridine-3-carbohydrazide (CAS 1592097-56-7) is a chemical compound with the molecular formula C6H5BrClN3O and a molecular weight of 250.48 g/mol. IUPAC name: 5-bromo-2-chloropyridine-3-carbohydrazide. InChIKey: RFXHMPQZPFKDCI-UHFFFAOYSA-N.
| Molecular formula | C6H5BrClN3O |
|---|---|
| Molecular weight | 250.48 g/mol |
| IUPAC name | 5-bromo-2-chloropyridine-3-carbohydrazide |
| InChIKey | RFXHMPQZPFKDCI-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)NN)Cl)Br |
Computed by PubChem (NCBI)