Products 1592097-56-7

CAS 1592097-56-7 is the registry number for 5-Bromo-2-chloro-nicotinic acid hydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-bromo-2-chloropyridine-3-carbohydrazide (CAS 1592097-56-7) is a chemical compound with the molecular formula C6H5BrClN3O and a molecular weight of 250.48 g/mol. IUPAC name: 5-bromo-2-chloropyridine-3-carbohydrazide. InChIKey: RFXHMPQZPFKDCI-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5BrClN3O
Molecular weight250.48 g/mol
IUPAC name5-bromo-2-chloropyridine-3-carbohydrazide
InChIKeyRFXHMPQZPFKDCI-UHFFFAOYSA-N
SMILESC1=C(C=NC(=C1C(=O)NN)Cl)Br

Computed by PubChem (NCBI)