CAS 15922-01-7 appears in our catalog under these names: 4-Nitrobenzoic acid potassium salt, 98%, Potassium 4–nitrobenzoate, 4-Nitrobenzoic Acid Potassium Salt, >99.0%(HPLC)(T), Benzoic acid, 4-nitro-, potassium salt (1:1), 98%, 98%, Potassium 4-nitrobenzoate, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g, 10g, 250mg.
Potassium 4-nitrobenzoate (CAS 15922-01-7) is a chemical compound with the molecular formula C7H4KNO4 and a molecular weight of 205.21 g/mol. IUPAC name: potassium 4-nitrobenzoate. InChIKey: MKBKSBKMELRIKB-UHFFFAOYSA-M.
| Molecular formula | C7H4KNO4 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | potassium 4-nitrobenzoate |
| InChIKey | MKBKSBKMELRIKB-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1C(=O)[O-])[N+](=O)[O-].[K+] |
Computed by PubChem (NCBI)