CAS 1592609-60-3 is the registry number for (2S)-2-Hydroxy-1-(piperazin-1-yl)propan-1-one, oxalic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-hydroxy-1-piperazin-1-ylpropan-1-one;oxalic acid (CAS 1592609-60-3) is a chemical compound with the molecular formula C9H16N2O6 and a molecular weight of 248.23 g/mol. IUPAC name: (2S)-2-hydroxy-1-piperazin-1-ylpropan-1-one;oxalic acid. InChIKey: ULIIMCIIMPWCFV-RGMNGODLSA-N.
| Molecular formula | C9H16N2O6 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | (2S)-2-hydroxy-1-piperazin-1-ylpropan-1-one;oxalic acid |
| InChIKey | ULIIMCIIMPWCFV-RGMNGODLSA-N |
| SMILES | C[C@@H](C(=O)N1CCNCC1)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)