CAS 159262-71-2 appears in our catalog under these names: 4-(Oxiran-2-yl)benzoic acid, 4-(Oxiran-2-yl)benzoic acid, 95+%. Offered by: Biosynth, AmBeed. Available pack sizes: 1000mg, 500mg, 1g.
4-(oxiran-2-yl)benzoic acid (CAS 159262-71-2) is a chemical compound with the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. IUPAC name: 4-(oxiran-2-yl)benzoic acid. InChIKey: VCZAQQDKQNHPDZ-UHFFFAOYSA-N.
| Molecular formula | C9H8O3 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | 4-(oxiran-2-yl)benzoic acid |
| InChIKey | VCZAQQDKQNHPDZ-UHFFFAOYSA-N |
| SMILES | C1C(O1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)