Products 159276-62-7

CAS 159276-62-7 is the registry number for Posaconazole Impurity 191. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Diethyl 2-[2-(2,4-difluorophenyl)prop-2-enyl]propanedioate (CAS 159276-62-7) is a chemical compound with the molecular formula C16H18F2O4 and a molecular weight of 312.31 g/mol. IUPAC name: diethyl 2-[2-(2,4-difluorophenyl)prop-2-enyl]propanedioate. InChIKey: ICXSWEPRNMGYGO-UHFFFAOYSA-N.

Identity
Molecular formulaC16H18F2O4
Molecular weight312.31 g/mol
IUPAC namediethyl 2-[2-(2,4-difluorophenyl)prop-2-enyl]propanedioate
InChIKeyICXSWEPRNMGYGO-UHFFFAOYSA-N
SMILESCCOC(=O)C(CC(=C)C1=C(C=C(C=C1)F)F)C(=O)OCC

Computed by PubChem (NCBI)