CAS 1592829-15-6 is the registry number for (t-Bu)2 MeP Pd G2, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Chloropalladium(1+);ditert-butyl(methyl)phosphane;2-phenylaniline (CAS 1592829-15-6) is a chemical compound with the molecular formula C21H31ClNPPd and a molecular weight of 470.3 g/mol. IUPAC name: chloropalladium(1+);ditert-butyl(methyl)phosphane;2-phenylaniline. InChIKey: CKVBPCIGHNKURW-UHFFFAOYSA-M.
| Molecular formula | C21H31ClNPPd |
|---|---|
| Molecular weight | 470.3 g/mol |
| IUPAC name | chloropalladium(1+);ditert-butyl(methyl)phosphane;2-phenylaniline |
| InChIKey | CKVBPCIGHNKURW-UHFFFAOYSA-M |
| SMILES | CC(C)(C)P(C)C(C)(C)C.C1=CC=C([C-]=C1)C2=CC=CC=C2N.Cl[Pd+] |
Computed by PubChem (NCBI)