CAS 15936-83-1 appears in our catalog under these names: 5-Chloro-7-methyl-1H-indole-3-carbaldehyde, 97%, 5–Chloro–7–methyl–1H–indole–3–carbaldehyde, 5-Chloro-7-methyl-1H-indole-3-carbaldehyde. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 10g, 100mg, 1g, 250mg, 2,5g.
5-chloro-7-methyl-1H-indole-3-carbaldehyde (CAS 15936-83-1) is a chemical compound with the molecular formula C10H8ClNO and a molecular weight of 193.63 g/mol. IUPAC name: 5-chloro-7-methyl-1H-indole-3-carbaldehyde. InChIKey: UTPKFSUXDCWZKF-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 5-chloro-7-methyl-1H-indole-3-carbaldehyde |
| InChIKey | UTPKFSUXDCWZKF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1NC=C2C=O)Cl |
Computed by PubChem (NCBI)