CAS 15937-51-6 is the registry number for 2-((2-Amino-5-(4-chlorophenyl)pyrimidin-4-yl)thio)acetic Acid. Offered by: TRC. Available pack sizes: 250mg.
2-[2-amino-5-(4-chlorophenyl)pyrimidin-4-yl]sulfanylacetic acid (CAS 15937-51-6) is a chemical compound with the molecular formula C12H10ClN3O2S and a molecular weight of 295.75 g/mol. IUPAC name: 2-[2-amino-5-(4-chlorophenyl)pyrimidin-4-yl]sulfanylacetic acid. InChIKey: MEYVVTRSYRLAHX-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN3O2S |
|---|---|
| Molecular weight | 295.75 g/mol |
| IUPAC name | 2-[2-amino-5-(4-chlorophenyl)pyrimidin-4-yl]sulfanylacetic acid |
| InChIKey | MEYVVTRSYRLAHX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(N=C2SCC(=O)O)N)Cl |
Computed by PubChem (NCBI)