Products 1593743-89-5

CAS 1593743-89-5 is the registry number for 2-((Methylsulfamoyl)amino)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(methylsulfamoylamino)acetic acid (CAS 1593743-89-5) is a chemical compound with the molecular formula C3H8N2O4S and a molecular weight of 168.17 g/mol. IUPAC name: 2-(methylsulfamoylamino)acetic acid. InChIKey: JUENWDOXRJJIOO-UHFFFAOYSA-N.

Identity
Molecular formulaC3H8N2O4S
Molecular weight168.17 g/mol
IUPAC name2-(methylsulfamoylamino)acetic acid
InChIKeyJUENWDOXRJJIOO-UHFFFAOYSA-N
SMILESCNS(=O)(=O)NCC(=O)O

Computed by PubChem (NCBI)