Products 1593842-75-1

CAS 1593842-75-1 appears in our catalog under these names: Fmoc-Lys(tBu)-OH 95%, Fmoc-L-Lys(tBu)-OH, 95%, 95%, Fmoc-L-Lys(tBu)-OH, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2S)-6-(tert-butylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 1593842-75-1) is a chemical compound with the molecular formula C25H32N2O4 and a molecular weight of 424.5 g/mol. IUPAC name: (2S)-6-(tert-butylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: UZCNNLFQCGSHPQ-QFIPXVFZSA-N.

Identity
Molecular formulaC25H32N2O4
Molecular weight424.5 g/mol
IUPAC name(2S)-6-(tert-butylamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid
InChIKeyUZCNNLFQCGSHPQ-QFIPXVFZSA-N
SMILESCC(C)(C)NCCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13

Computed by PubChem (NCBI)