Products 159427-77-7

CAS 159427-77-7 is the registry number for 1-Methyl-4-nitropyrazole-3,5-dicarboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

1-methyl-4-nitropyrazole-3,5-dicarboxylic acid (CAS 159427-77-7) is a chemical compound with the molecular formula C6H5N3O6 and a molecular weight of 215.12 g/mol. IUPAC name: 1-methyl-4-nitropyrazole-3,5-dicarboxylic acid. InChIKey: MJLKEYGTMZKPAL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5N3O6
Molecular weight215.12 g/mol
IUPAC name1-methyl-4-nitropyrazole-3,5-dicarboxylic acid
InChIKeyMJLKEYGTMZKPAL-UHFFFAOYSA-N
SMILESCN1C(=C(C(=N1)C(=O)O)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)