CAS 15944-78-2 appears in our catalog under these names: 5,7-Dichloro-4-nitro-2,1,3-benzoxadiazole, 95%, 5,7-Dichloro-4-nitrobenzo(c)(1,2,5)oxadiazole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 10g, 25g, 1g.
5,7-dichloro-4-nitro-2,1,3-benzoxadiazole (CAS 15944-78-2) is a chemical compound with the molecular formula C6HCl2N3O3 and a molecular weight of 233.99 g/mol. IUPAC name: 5,7-dichloro-4-nitro-2,1,3-benzoxadiazole. InChIKey: SCVFVTLATGCDGT-UHFFFAOYSA-N.
| Molecular formula | C6HCl2N3O3 |
|---|---|
| Molecular weight | 233.99 g/mol |
| IUPAC name | 5,7-dichloro-4-nitro-2,1,3-benzoxadiazole |
| InChIKey | SCVFVTLATGCDGT-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NON=C2C(=C1Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)