CAS 1594864-96-6 appears in our catalog under these names: 5–(Chlorosulfonyl)–4–fluoro–2–methylbenzoyl chloride, 5-(Chlorosulfonyl)-4-fluoro-2-methylbenzoyl chloride, 90%, 90%, 5-(CHLOROSULFONYL)-4-FLUORO-2-METHYLBENZOYL CHLORIDE, 90%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg.
5-chlorosulfonyl-4-fluoro-2-methylbenzoyl chloride (CAS 1594864-96-6) is a chemical compound with the molecular formula C8H5Cl2FO3S and a molecular weight of 271.09 g/mol. IUPAC name: 5-chlorosulfonyl-4-fluoro-2-methylbenzoyl chloride. InChIKey: LHGAFIRKIARBCN-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2FO3S |
|---|---|
| Molecular weight | 271.09 g/mol |
| IUPAC name | 5-chlorosulfonyl-4-fluoro-2-methylbenzoyl chloride |
| InChIKey | LHGAFIRKIARBCN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)Cl)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)