CAS 1594924-27-2 appears in our catalog under these names: 5-Bromo-4-fluoro-1-N-isopropylbenzene-1,2-diamine, 98%, 5-Bromo-4-fluoro-N1-isopropylbenzene-1,2-diamine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
4-bromo-5-fluoro-2-N-propan-2-ylbenzene-1,2-diamine (CAS 1594924-27-2) is a chemical compound with the molecular formula C9H12BrFN2 and a molecular weight of 247.11 g/mol. IUPAC name: 4-bromo-5-fluoro-2-N-propan-2-ylbenzene-1,2-diamine. InChIKey: MTOWUOADISBQKD-UHFFFAOYSA-N.
| Molecular formula | C9H12BrFN2 |
|---|---|
| Molecular weight | 247.11 g/mol |
| IUPAC name | 4-bromo-5-fluoro-2-N-propan-2-ylbenzene-1,2-diamine |
| InChIKey | MTOWUOADISBQKD-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=CC(=C(C=C1N)F)Br |
Computed by PubChem (NCBI)