CAS 1595213-19-6 is the registry number for (S)-2-Amino-N-(cyclopentylmethyl)-N,3-dimethylbutanamide hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-N-(cyclopentylmethyl)-N,3-dimethylbutanamide;hydrochloride (CAS 1595213-19-6) is a chemical compound with the molecular formula C12H25ClN2O and a molecular weight of 248.79 g/mol. IUPAC name: (2S)-2-amino-N-(cyclopentylmethyl)-N,3-dimethylbutanamide;hydrochloride. InChIKey: GDOKGXOISQQFSY-MERQFXBCSA-N.
| Molecular formula | C12H25ClN2O |
|---|---|
| Molecular weight | 248.79 g/mol |
| IUPAC name | (2S)-2-amino-N-(cyclopentylmethyl)-N,3-dimethylbutanamide;hydrochloride |
| InChIKey | GDOKGXOISQQFSY-MERQFXBCSA-N |
| SMILES | CC(C)[C@@H](C(=O)N(C)CC1CCCC1)N.Cl |
Computed by PubChem (NCBI)