Products 159549-89-0
CAS 159549-89-0 appears in our catalog under these names: Carfilzomib Impurity 43, Benzyl L-leucyl-D-phenylalaninate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2R)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-phenylpropanoate;hydrochloride (CAS 159549-89-0) is a chemical compound with the molecular formula C22H29ClN2O3 and a molecular weight of 404.9 g/mol. IUPAC name: benzyl (2R)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-phenylpropanoate;hydrochloride. InChIKey: OVQDQJLFQHBUGB-CMXBXVFLSA-N.
| Molecular formula | C22H29ClN2O3 |
|---|---|
| Molecular weight | 404.9 g/mol |
| IUPAC name | benzyl (2R)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-phenylpropanoate;hydrochloride |
| InChIKey | OVQDQJLFQHBUGB-CMXBXVFLSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N[C@H](CC1=CC=CC=C1)C(=O)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)