CAS 15959-35-0 is the registry number for 2,4,6-Triphenylpyrylium, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4,6-triphenylpyrylium (CAS 15959-35-0) is a chemical compound with the molecular formula C23H17O+ and a molecular weight of 309.4 g/mol. IUPAC name: 2,4,6-triphenylpyrylium. InChIKey: AGOUUEWPLMNUJL-UHFFFAOYSA-N.
| Molecular formula | C23H17O+ |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | 2,4,6-triphenylpyrylium |
| InChIKey | AGOUUEWPLMNUJL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=[O+]C(=C2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)