CAS 1595959-15-1 is the registry number for 7-Bromo-3-methyl-1,2-dihydroisoquinolin-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-bromo-3-methyl-2H-isoquinolin-1-one (CAS 1595959-15-1) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 7-bromo-3-methyl-2H-isoquinolin-1-one. InChIKey: GUKPMOGOOWYGPF-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 7-bromo-3-methyl-2H-isoquinolin-1-one |
| InChIKey | GUKPMOGOOWYGPF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C(C=C2)Br)C(=O)N1 |
Computed by PubChem (NCBI)