Products 15960-79-9

CAS 15960-79-9 is the registry number for 1,3-Bis(1,1-dimethylethyl) 2-bromopropanedioate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

Ditert-butyl 2-bromopropanedioate (CAS 15960-79-9) is a chemical compound with the molecular formula C11H19BrO4 and a molecular weight of 295.17 g/mol. IUPAC name: ditert-butyl 2-bromopropanedioate. InChIKey: MXQKZYBGLSKJNU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H19BrO4
Molecular weight295.17 g/mol
IUPAC nameditert-butyl 2-bromopropanedioate
InChIKeyMXQKZYBGLSKJNU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C(C(=O)OC(C)(C)C)Br

Computed by PubChem (NCBI)