CAS 1596348-32-1 appears in our catalog under these names: KDM5-C70, KDM5-C70, 98%, KDOAM 21, KDM5–C70, ethyl 2-(((2-((2-(dimethylamino)ethyl)(ethyl)amino)-2-oxoethyl)amino)methyl)isonicotinate, 98.00% ,, 98.00% ,. Offered by: TRC, AmBeed, TargetMol, GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 2mg, 5mg, 10mg, 25mg, 50mg, 200mg.
Ethyl 2-[[[2-[2-(dimethylamino)ethyl-ethylamino]-2-oxoethyl]amino]methyl]pyridine-4-carboxylate (CAS 1596348-32-1) is a chemical compound with the molecular formula C17H28N4O3 and a molecular weight of 336.4 g/mol. IUPAC name: ethyl 2-[[[2-[2-(dimethylamino)ethyl-ethylamino]-2-oxoethyl]amino]methyl]pyridine-4-carboxylate. InChIKey: WCILOMUUNVPIKQ-UHFFFAOYSA-N.
| Molecular formula | C17H28N4O3 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | ethyl 2-[[[2-[2-(dimethylamino)ethyl-ethylamino]-2-oxoethyl]amino]methyl]pyridine-4-carboxylate |
| InChIKey | WCILOMUUNVPIKQ-UHFFFAOYSA-N |
| SMILES | CCN(CCN(C)C)C(=O)CNCC1=NC=CC(=C1)C(=O)OCC |
Computed by PubChem (NCBI)