CAS 159639-63-1 is the registry number for 5,6-Dibromo-3,4-dihydronaphthalen-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-dibromo-3,4-dihydro-2H-naphthalen-1-one (CAS 159639-63-1) is a chemical compound with the molecular formula C10H8Br2O and a molecular weight of 303.98 g/mol. IUPAC name: 5,6-dibromo-3,4-dihydro-2H-naphthalen-1-one. InChIKey: GJFGSZWEVKQEBP-UHFFFAOYSA-N.
| Molecular formula | C10H8Br2O |
|---|---|
| Molecular weight | 303.98 g/mol |
| IUPAC name | 5,6-dibromo-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | GJFGSZWEVKQEBP-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2Br)Br)C(=O)C1 |
Computed by PubChem (NCBI)