CAS 15965-32-9 is the registry number for 2,5-Dichloro-4-nitroimidazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,4-dichloro-5-nitro-1H-imidazole (CAS 15965-32-9) is a chemical compound with the molecular formula C3HCl2N3O2 and a molecular weight of 181.96 g/mol. IUPAC name: 2,4-dichloro-5-nitro-1H-imidazole. InChIKey: XJHISXIOFMXKNU-UHFFFAOYSA-N.
| Molecular formula | C3HCl2N3O2 |
|---|---|
| Molecular weight | 181.96 g/mol |
| IUPAC name | 2,4-dichloro-5-nitro-1H-imidazole |
| InChIKey | XJHISXIOFMXKNU-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(N1)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)