CAS 1597-19-9 is the registry number for N-(trifluoroacetyl)-Alanyl Chloride. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2,2,2-trifluoroacetyl)amino]propanoyl chloride (CAS 1597-19-9) is a chemical compound with the molecular formula C5H5ClF3NO2 and a molecular weight of 203.55 g/mol. IUPAC name: 2-[(2,2,2-trifluoroacetyl)amino]propanoyl chloride. InChIKey: HSEUXFSGFQCJCU-UHFFFAOYSA-N.
| Molecular formula | C5H5ClF3NO2 |
|---|---|
| Molecular weight | 203.55 g/mol |
| IUPAC name | 2-[(2,2,2-trifluoroacetyl)amino]propanoyl chloride |
| InChIKey | HSEUXFSGFQCJCU-UHFFFAOYSA-N |
| SMILES | CC(C(=O)Cl)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)