Products 1597-19-9

CAS 1597-19-9 is the registry number for N-(trifluoroacetyl)-Alanyl Chloride. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(2,2,2-trifluoroacetyl)amino]propanoyl chloride (CAS 1597-19-9) is a chemical compound with the molecular formula C5H5ClF3NO2 and a molecular weight of 203.55 g/mol. IUPAC name: 2-[(2,2,2-trifluoroacetyl)amino]propanoyl chloride. InChIKey: HSEUXFSGFQCJCU-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5ClF3NO2
Molecular weight203.55 g/mol
IUPAC name2-[(2,2,2-trifluoroacetyl)amino]propanoyl chloride
InChIKeyHSEUXFSGFQCJCU-UHFFFAOYSA-N
SMILESCC(C(=O)Cl)NC(=O)C(F)(F)F

Computed by PubChem (NCBI)