CAS 159717-69-8 appears in our catalog under these names: (R)-(+)-Nbd-pro-cocl, 95%, (R)-(+)-NBD-Pro-COCl [=(R)-(+)-4-Nitro-7-(2-chloroformylpyrrolidin-1-yl)-2,1,3-benzoxadiazole] [HPLC Labeling Reagent for e.e. Determination], >98.0%(HPLC). Offered by: Combi-blocks, TCI. Available pack sizes: 100mg.
(2R)-1-(4-nitro-2,1,3-benzoxadiazol-7-yl)pyrrolidine-2-carbonyl chloride (CAS 159717-69-8) is a chemical compound with the molecular formula C11H9ClN4O4 and a molecular weight of 296.66 g/mol. IUPAC name: (2R)-1-(4-nitro-2,1,3-benzoxadiazol-7-yl)pyrrolidine-2-carbonyl chloride. InChIKey: XBQYXPYABMCADZ-MRVPVSSYSA-N.
| Molecular formula | C11H9ClN4O4 |
|---|---|
| Molecular weight | 296.66 g/mol |
| IUPAC name | (2R)-1-(4-nitro-2,1,3-benzoxadiazol-7-yl)pyrrolidine-2-carbonyl chloride |
| InChIKey | XBQYXPYABMCADZ-MRVPVSSYSA-N |
| SMILES | C1C[C@@H](N(C1)C2=CC=C(C3=NON=C23)[N+](=O)[O-])C(=O)Cl |
Computed by PubChem (NCBI)