CAS 1597260-56-4 appears in our catalog under these names: 3-Bromo-2-iodo-5-nitropyridine, 95%, 3-BROMO-2-IODO-5-NITROPYRIDINE, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
3-bromo-2-iodo-5-nitropyridine (CAS 1597260-56-4) is a chemical compound with the molecular formula C5H2BrIN2O2 and a molecular weight of 328.89 g/mol. IUPAC name: 3-bromo-2-iodo-5-nitropyridine. InChIKey: ZDIOXNCJOHNQAT-UHFFFAOYSA-N.
| Molecular formula | C5H2BrIN2O2 |
|---|---|
| Molecular weight | 328.89 g/mol |
| IUPAC name | 3-bromo-2-iodo-5-nitropyridine |
| InChIKey | ZDIOXNCJOHNQAT-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Br)I)[N+](=O)[O-] |
Computed by PubChem (NCBI)