CAS 159727-27-2 is the registry number for 2-Amino-5-(pentafluorothio)benzonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg.
2-amino-5-(pentafluoro-lambda6-sulfanyl)benzonitrile (CAS 159727-27-2) is a chemical compound with the molecular formula C7H5F5N2S and a molecular weight of 244.19 g/mol. IUPAC name: 2-amino-5-(pentafluoro-lambda6-sulfanyl)benzonitrile. InChIKey: QCSKWNLAJJVWTM-UHFFFAOYSA-N.
| Molecular formula | C7H5F5N2S |
|---|---|
| Molecular weight | 244.19 g/mol |
| IUPAC name | 2-amino-5-(pentafluoro-lambda6-sulfanyl)benzonitrile |
| InChIKey | QCSKWNLAJJVWTM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(F)(F)(F)(F)F)C#N)N |
Computed by PubChem (NCBI)