CAS 159727-88-5 appears in our catalog under these names: 2-Cyano-3-methyl pyridine-n-oxide, 95%, 2-Cyano-3-methylpyridine-N-oxide, 97%, 97%, 2-Cyano-3-methylpyridine 1-oxide, 97%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g.
3-methyl-1-oxidopyridin-1-ium-2-carbonitrile (CAS 159727-88-5) is a chemical compound with the molecular formula C7H6N2O and a molecular weight of 134.14 g/mol. IUPAC name: 3-methyl-1-oxidopyridin-1-ium-2-carbonitrile. InChIKey: OTXYVTPSEMLVLS-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O |
|---|---|
| Molecular weight | 134.14 g/mol |
| IUPAC name | 3-methyl-1-oxidopyridin-1-ium-2-carbonitrile |
| InChIKey | OTXYVTPSEMLVLS-UHFFFAOYSA-N |
| SMILES | CC1=C([N+](=CC=C1)[O-])C#N |
Computed by PubChem (NCBI)