CAS 159730-12-8 appears in our catalog under these names: 6-Methyltryptamine Hydrochloride, 6-Methyltryptamine hydrochloride, 95%, 95%. Offered by: TRC, Chemat. Available pack sizes: 1g, 100mg, 250mg.
2-(6-methyl-1H-indol-3-yl)ethanamine;hydrochloride (CAS 159730-12-8) is a chemical compound with the molecular formula C11H15ClN2 and a molecular weight of 210.70 g/mol. IUPAC name: 2-(6-methyl-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: GKPUOKJJOBXAMP-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2 |
|---|---|
| Molecular weight | 210.70 g/mol |
| IUPAC name | 2-(6-methyl-1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | GKPUOKJJOBXAMP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=CN2)CCN.Cl |
Computed by PubChem (NCBI)