CAS 1597410-36-0 is the registry number for (E)-S-Methyl 4-(4-(benzyloxy)-3-methoxyphenyl)-2-oxobut-3-enethioate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
S-methyl (E)-4-(3-methoxy-4-phenylmethoxyphenyl)-2-oxobut-3-enethioate (CAS 1597410-36-0) is a chemical compound with the molecular formula C19H18O4S and a molecular weight of 342.4 g/mol. IUPAC name: S-methyl (E)-4-(3-methoxy-4-phenylmethoxyphenyl)-2-oxobut-3-enethioate. InChIKey: XWFXQVZTYXOHPH-CSKARUKUSA-N.
| Molecular formula | C19H18O4S |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | S-methyl (E)-4-(3-methoxy-4-phenylmethoxyphenyl)-2-oxobut-3-enethioate |
| InChIKey | XWFXQVZTYXOHPH-CSKARUKUSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C/C(=O)C(=O)SC)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)