CAS 1597489-14-9 appears in our catalog under these names: Ml401, 95%, ML401, (E)-3-(4-Bromophenyl)-1-(4-(4-chlorobenzyl)piperazin-1-yl)prop-2-en-1-one, 99%, 99%, ML401, 99.93%, ML401, 99%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 250mg, 100mg, 1g, 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 25mg.
(E)-3-(4-bromophenyl)-1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]prop-2-en-1-one (CAS 1597489-14-9) is a chemical compound with the molecular formula C20H20BrClN2O and a molecular weight of 419.7 g/mol. IUPAC name: (E)-3-(4-bromophenyl)-1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]prop-2-en-1-one. InChIKey: NXTNVQJKGHAGAX-BJMVGYQFSA-N.
| Molecular formula | C20H20BrClN2O |
|---|---|
| Molecular weight | 419.7 g/mol |
| IUPAC name | (E)-3-(4-bromophenyl)-1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]prop-2-en-1-one |
| InChIKey | NXTNVQJKGHAGAX-BJMVGYQFSA-N |
| SMILES | C1CN(CCN1CC2=CC=C(C=C2)Cl)C(=O)/C=C/C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)