Products 1597532-47-2
CAS 1597532-47-2 is the registry number for [1,1′:4′,1″-Terphenyl]-3,3″- dicarboxylic acid, 2,2″,4,4″,6,6″- hexamethyl-, 3,3″-dimethyl ester, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
Methyl 3-[4-(3-methoxycarbonyl-2,4,6-trimethylphenyl)phenyl]-2,4,6-trimethylbenzoate (CAS 1597532-47-2) is a chemical compound with the molecular formula C28H30O4 and a molecular weight of 430.5 g/mol. IUPAC name: methyl 3-[4-(3-methoxycarbonyl-2,4,6-trimethylphenyl)phenyl]-2,4,6-trimethylbenzoate. InChIKey: IANUDESWVWHOND-UHFFFAOYSA-N.
| Molecular formula | C28H30O4 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | methyl 3-[4-(3-methoxycarbonyl-2,4,6-trimethylphenyl)phenyl]-2,4,6-trimethylbenzoate |
| InChIKey | IANUDESWVWHOND-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C2=CC=C(C=C2)C3=C(C(=C(C=C3C)C)C(=O)OC)C)C)C(=O)OC)C |
Computed by PubChem (NCBI)