CAS 159776-80-4 is the registry number for O-Desethyl-O-methyl Chlorpyrifos. Offered by: TRC. Available pack sizes: 100mg.
Ethoxy-methoxy-sulfanylidene-[(3,5,6-trichloro-2-pyridinyl)oxy]-lambda5-phosphane (CAS 159776-80-4) is a chemical compound with the molecular formula C8H9Cl3NO3PS and a molecular weight of 336.6 g/mol. IUPAC name: ethoxy-methoxy-sulfanylidene-[(3,5,6-trichloro-2-pyridinyl)oxy]-lambda5-phosphane. InChIKey: JVPFGGFTJGNSEM-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl3NO3PS |
|---|---|
| Molecular weight | 336.6 g/mol |
| IUPAC name | ethoxy-methoxy-sulfanylidene-[(3,5,6-trichloro-2-pyridinyl)oxy]-lambda5-phosphane |
| InChIKey | JVPFGGFTJGNSEM-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OC)OC1=NC(=C(C=C1Cl)Cl)Cl |
Computed by PubChem (NCBI)