CAS 15978-68-4 appears in our catalog under these names: Calcium tetrafluoroborate hydrate, CALCIUM TETRAFLUOROBORATE, ≥98%, ≥98%. Offered by: GLPBio, Chemat. Available pack sizes: 25g, 5g, 1g.
Calcium ditetrafluoroborate (CAS 15978-68-4) is a chemical compound with the molecular formula B2CaF8 and a molecular weight of 213.69 g/mol. IUPAC name: calcium ditetrafluoroborate. InChIKey: YHLNCCJTKRTQEG-UHFFFAOYSA-N.
| Molecular formula | B2CaF8 |
|---|---|
| Molecular weight | 213.69 g/mol |
| IUPAC name | calcium ditetrafluoroborate |
| InChIKey | YHLNCCJTKRTQEG-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.[B-](F)(F)(F)F.[Ca+2] |
Computed by PubChem (NCBI)