CAS 1597963-23-9 appears in our catalog under these names: 8-Bromo-3-methyl-1,2-dihydroisoquinolin-1-one, 95%, 8-Bromo-3-methyl-1,2-dihydroisoquinolin-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
8-bromo-3-methyl-2H-isoquinolin-1-one (CAS 1597963-23-9) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 8-bromo-3-methyl-2H-isoquinolin-1-one. InChIKey: AKZYODAXWHQLGP-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 8-bromo-3-methyl-2H-isoquinolin-1-one |
| InChIKey | AKZYODAXWHQLGP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=CC=C2)Br)C(=O)N1 |
Computed by PubChem (NCBI)