CAS 1598224-29-3 is the registry number for 2-{((2R,6S)-2,6-Dimethylmorpholin-4-yl)sulfonyl}ethan-1-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylethanol (CAS 1598224-29-3) is a chemical compound with the molecular formula C8H17NO4S and a molecular weight of 223.29 g/mol. IUPAC name: 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylethanol. InChIKey: LWOZWVAAAZRALO-OCAPTIKFSA-N.
| Molecular formula | C8H17NO4S |
|---|---|
| Molecular weight | 223.29 g/mol |
| IUPAC name | 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylethanol |
| InChIKey | LWOZWVAAAZRALO-OCAPTIKFSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)S(=O)(=O)CCO |
Computed by PubChem (NCBI)