CAS 159874-34-7 appears in our catalog under these names: 4-Isopropylamino-piperidine-1-carboxylic acid benzyl ester, 95%, 4-Isopropylamino-piperidine-1-carboxylic acid benzyl ester, 95+%, 4-Isopropylamino-piperidine-1-carboxylic acid benzyl ester, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
Benzyl 4-(propan-2-ylamino)piperidine-1-carboxylate (CAS 159874-34-7) is a chemical compound with the molecular formula C16H24N2O2 and a molecular weight of 276.37 g/mol. IUPAC name: benzyl 4-(propan-2-ylamino)piperidine-1-carboxylate. InChIKey: WVCCTTCYYHHOIR-UHFFFAOYSA-N.
| Molecular formula | C16H24N2O2 |
|---|---|
| Molecular weight | 276.37 g/mol |
| IUPAC name | benzyl 4-(propan-2-ylamino)piperidine-1-carboxylate |
| InChIKey | WVCCTTCYYHHOIR-UHFFFAOYSA-N |
| SMILES | CC(C)NC1CCN(CC1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)